5332-96-7 4-Nitrophenylacetone
product Name |
4-Nitrophenylacetone |
CAS No |
5332-96-7 |
Synonyms |
1-(4-Nitrophenyl)-2-propanone; 1-(4-nitrophenyl)propan-2-one |
Molecular Formula |
C9H9NO3 |
Molecular Weight |
179.1727 |
InChI |
InChI=1/C9H9NO3/c1-7(11)6-8-2-4-9(5-3-8)10(12)13/h2-5H,6H2,1H3 |
Molecular Structure |
|
Density |
1.212g/cm3 |
Melting point |
63-64℃ |
Boiling point |
307.5°C at 760 mmHg |
Refractive index |
1.549 |
Flash point |
146.4°C |
Vapour Pressur |
0.000724mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|