ChemNet > CAS > 5356-71-8 1,3-diphenyl-1H-pyrazol-5-amine
5356-71-8 1,3-diphenyl-1H-pyrazol-5-amine
| product Name |
1,3-diphenyl-1H-pyrazol-5-amine |
| CAS No |
5356-71-8 |
| Synonyms |
5-Amino-1,3-diphenylpyrazole |
| Molecular Formula |
C15H13N3 |
| Molecular Weight |
235.2838 |
| InChI |
InChI=1/C15H13N3/c16-15-11-14(12-7-3-1-4-8-12)17-18(15)13-9-5-2-6-10-13/h1-11H,16H2 |
| Molecular Structure |
|
| Density |
1.17g/cm3 |
| Melting point |
129℃ |
| Boiling point |
454°C at 760 mmHg |
| Refractive index |
1.646 |
| Flash point |
228.4°C |
| Vapour Pressur |
1.98E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
