ChemNet > CAS > 536-59-4 L(-)-Perillyl alcohol
536-59-4 L(-)-Perillyl alcohol
| product Name |
L(-)-Perillyl alcohol |
| CAS No |
536-59-4 |
| Synonyms |
4-isopropenylcyclohex-1-en-1-ylmethanol; [4-(prop-1-en-2-yl)cyclohex-1-en-1-yl]methanol; [(4S)-4-(prop-1-en-2-yl)cyclohex-1-en-1-yl]methanol; Dihydro cuminyl alcohol |
| Molecular Formula |
C10H16O |
| Molecular Weight |
152.2334 |
| InChI |
InChI=1/C10H16O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,10-11H,1,4-7H2,2H3/t10-/m1/s1 |
| EINECS |
208-639-9 |
| Molecular Structure |
|
| Density |
0.94g/cm3 |
| Boiling point |
241.2°C at 760 mmHg |
| Refractive index |
1.491 |
| Flash point |
99.6°C |
| Vapour Pressur |
0.00628mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
