538-58-9 Dibenzylideneacetone
product Name |
Dibenzylideneacetone |
CAS No |
538-58-9;35225-79-7 |
Synonyms |
1,5-Diphenyl-1,4-pentadien-3-one; distyryl ketone; trans,trans-Dibenzylideneacetone; Dibenzylidene acetone; 1,5-diphenylpenta-1,4-dien-3-one; (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one; (1Z,4Z)-1,5-diphenylpenta-1,4-dien-3-one; (1E)-1,5-diphenylpenta-1,4-dien-3-one; 1,5-Diphenyl-3-pentadienone |
Molecular Formula |
C17H14O |
Molecular Weight |
234.2925 |
InChI |
InChI=1/C17H14O/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-14H/b13-11+,14-12u |
EINECS |
208-697-5 |
Molecular Structure |
|
Density |
1.1g/cm3 |
Melting point |
112-114℃ |
Boiling point |
400.7°C at 760 mmHg |
Refractive index |
1.649 |
Flash point |
176.2°C |
Vapour Pressur |
1.25E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|