ChemNet > CAS > 538-62-5 Phenylazoformic acid 2-phenylhydrazide
538-62-5 Phenylazoformic acid 2-phenylhydrazide
| product Name |
Phenylazoformic acid 2-phenylhydrazide |
| CAS No |
538-62-5 |
| Synonyms |
SYM-DIPHENYLCARBAZONE; (E)-N',2-diphenyldiazenecarbohydrazide; Diphenylcarbazone; Diphenyl carbazone |
| Molecular Formula |
C13H12N4O |
| Molecular Weight |
240.2606 |
| InChI |
InChI=1/C13H12N4O/c18-13(16-14-11-7-3-1-4-8-11)17-15-12-9-5-2-6-10-12/h1-10,14H,(H,16,18)/b17-15- |
| EINECS |
208-698-0 |
| Molecular Structure |
|
| Melting point |
153-157℃ |
| Refractive index |
1.617 |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
