ChemNet > CAS > 5380-42-7 Thiophene-2-carboxylic acid methy lester
5380-42-7 Thiophene-2-carboxylic acid methy lester
| product Name |
Thiophene-2-carboxylic acid methy lester |
| CAS No |
5380-42-7 |
| Synonyms |
Thiophene-2-carboxylic acid methyl ester; Methyl thiophene-2-carboxylate |
| Molecular Formula |
C6H6O2S |
| Molecular Weight |
142.1756 |
| InChI |
InChI=1/C6H6O2S/c1-8-6(7)5-3-2-4-9-5/h2-4H,1H3 |
| EINECS |
226-371-0 |
| Molecular Structure |
|
| Density |
1.217g/cm3 |
| Boiling point |
200.2°C at 760 mmHg |
| Refractive index |
1.535 |
| Flash point |
74.9°C |
| Vapour Pressur |
0.329mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
