ChemNet > CAS > 5392-12-1 2-Methoxy-1-naphthaldehyde
5392-12-1 2-Methoxy-1-naphthaldehyde
| product Name |
2-Methoxy-1-naphthaldehyde |
| CAS No |
5392-12-1 |
| Synonyms |
2-Methoxy-1-naphthylaldehyde; NSC 28471; NSC 3256; 2-methoxynaphthalene-1-carbaldehyde |
| Molecular Formula |
C12H10O2 |
| Molecular Weight |
186.2066 |
| InChI |
InChI=1/C12H10O2/c1-14-12-7-6-9-4-2-3-5-10(9)11(12)8-13/h2-8H,1H3 |
| EINECS |
226-392-5 |
| Molecular Structure |
|
| Density |
1.169g/cm3 |
| Melting point |
81-84℃ |
| Boiling point |
339.1°C at 760 mmHg |
| Refractive index |
1.642 |
| Flash point |
167.4°C |
| Vapour Pressur |
9.39E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
