ChemNet > CAS > 5398-11-8 3-Phenyl-1(3H)-isobenzofuranone
5398-11-8 3-Phenyl-1(3H)-isobenzofuranone
| product Name |
3-Phenyl-1(3H)-isobenzofuranone |
| CAS No |
5398-11-8 |
| Synonyms |
3-Phenylphthalide; 3-phenyl-2-benzofuran-1(3H)-one; (3S)-3-phenyl-2-benzofuran-1(3H)-one; (3R)-3-phenyl-2-benzofuran-1(3H)-one |
| Molecular Formula |
C14H10O2 |
| Molecular Weight |
210.228 |
| InChI |
InChI=1/C14H10O2/c15-14-12-9-5-4-8-11(12)13(16-14)10-6-2-1-3-7-10/h1-9,13H/t13-/m1/s1 |
| EINECS |
226-426-9 |
| Molecular Structure |
|
| Density |
1.234g/cm3 |
| Boiling point |
368.9°C at 760 mmHg |
| Refractive index |
1.622 |
| Flash point |
154.5°C |
| Vapour Pressur |
1.23E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
