ChemNet > CAS > 5400-81-7 ethyl 4-amino-3,5-diiodobenzoate
5400-81-7 ethyl 4-amino-3,5-diiodobenzoate
| product Name |
ethyl 4-amino-3,5-diiodobenzoate |
| CAS No |
5400-81-7 |
| Molecular Formula |
C9H9I2NO2 |
| Molecular Weight |
416.9822 |
| InChI |
InChI=1/C9H9I2NO2/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4H,2,12H2,1H3 |
| Molecular Structure |
|
| Density |
2.191g/cm3 |
| Melting point |
148℃ |
| Boiling point |
449.1°C at 760 mmHg |
| Refractive index |
1.689 |
| Flash point |
225.4°C |
| Vapour Pressur |
2.93E-08mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
