541-46-8 isovaleramide
product Name |
isovaleramide |
CAS No |
541-46-8 |
Synonyms |
Isovaleramide, (3-Methylbutyramide); 3-Methylbutyramide; 3-Methylbutanamide |
Molecular Formula |
C5H11NO |
Molecular Weight |
101.1469 |
InChI |
InChI=1/C5H11NO/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H2,6,7) |
EINECS |
208-781-1 |
Molecular Structure |
|
Density |
0.901g/cm3 |
Boiling point |
232°C at 760 mmHg |
Refractive index |
1.425 |
Flash point |
94.1°C |
Vapour Pressur |
0.0605mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|