CAS No: 5413-60-5, Chemical Name: 3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-6-yl acetate
the physical and chemical property of 5413-60-5, 3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-6-yl acetate is provided by ChemNet.com
ChemNet > CAS > 5413-60-5 3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-6-yl acetate
5413-60-5 3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-6-yl acetate
| product Name |
3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-6-yl acetate |
| Synonyms |
Jasmacyclene; 3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoinden-6-yl acetate; Verdyl Acetate |
| Molecular Formula |
C12H16O2 |
| Molecular Weight |
192.2542 |
| InChI |
InChI=1/C12H16O2/c1-7(13)14-12-6-8-5-11(12)10-4-2-3-9(8)10/h2-3,8-12H,4-6H2,1H3 |
| CAS Registry Number |
5413-60-5 |
| EINECS |
226-501-6 |
| Molecular Structure |
|
| Density |
1.12g/cm3 |
| Boiling point |
258.4°C at 760 mmHg |
| Refractive index |
1.536 |
| Flash point |
101.8°C |
| Vapour Pressur |
0.0137mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
