ChemNet > CAS > 5417-82-3 ethoxyethylidene malononitrile
5417-82-3 ethoxyethylidene malononitrile
| product Name |
ethoxyethylidene malononitrile |
| CAS No |
5417-82-3 |
| Synonyms |
Propanedinitrile, 2-(1-ethoxyethylidene)-; (1-Ethoxyethylidene)propanedinitrile; 1-Ethoxyethylidenemalononitrile; 4-03-00-01196 (Beilstein Handbook Reference); BRN 0906913; NSC 11585; Malononitrile, (1-ethoxyethylidene)-; Propanedinitrile, (1-ethoxyethylidene)- |
| Molecular Formula |
C7H8N2O |
| Molecular Weight |
136.1512 |
| InChI |
InChI=1/C7H8N2O/c1-3-10-6(2)7(4-8)5-9/h3H2,1-2H3 |
| EINECS |
226-521-5 |
| Molecular Structure |
|
| Density |
1.043g/cm3 |
| Melting point |
89-92℃ |
| Boiling point |
312.6°C at 760 mmHg |
| Refractive index |
1.461 |
| Flash point |
137.1°C |
| Vapour Pressur |
0.000524mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
