543-20-4 Succinyl chloride
product Name |
Succinyl chloride |
CAS No |
543-20-4 |
Synonyms |
Succinic acid dichloride; Succinyl dichloride; Succinoyl dichloride; Butanedioyl dichloride |
Molecular Formula |
C4H4Cl2O2 |
Molecular Weight |
154.9794 |
InChI |
InChI=1/C4H4Cl2O2/c5-3(7)1-2-4(6)8/h1-2H2 |
EINECS |
208-838-0 |
Molecular Structure |
|
Density |
1.389g/cm3 |
Melting point |
16-17℃ |
Boiling point |
193.4°C at 760 mmHg |
Refractive index |
1.456 |
Flash point |
76.7°C |
Vapour Pressur |
0.466mmHg at 25°C |
Hazard Symbols |
C:Corrosive;
|
Risk Codes |
R34:Causes burns.;
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
MSDS |
Material Safety Data Sheet
|
|