ChemNet > CAS > 5438-36-8 5-Iodovanillin
5438-36-8 5-Iodovanillin
| product Name |
5-Iodovanillin |
| CAS No |
5438-36-8 |
| Synonyms |
4-Hydroxy-3-iodo-5-methoxybenzaldehyde |
| Molecular Formula |
C8H7IO3 |
| Molecular Weight |
278.0439 |
| InChI |
InChI=1/C8H7IO3/c1-12-7-3-5(4-10)2-6(9)8(7)11/h2-4,11H,1H3 |
| EINECS |
226-617-7 |
| Molecular Structure |
|
| Density |
1.909g/cm3 |
| Melting point |
180-184℃ |
| Boiling point |
304.1°C at 760 mmHg |
| Refractive index |
1.671 |
| Flash point |
137.7°C |
| Vapour Pressur |
0.000498mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
