ChemNet > CAS > 544-47-8 S-(4-Chlorobenzyl)thiuronium chloride
544-47-8 S-(4-Chlorobenzyl)thiuronium chloride
| product Name |
S-(4-Chlorobenzyl)thiuronium chloride |
| CAS No |
544-47-8 |
| Synonyms |
2-(4-Chlorobenzyl)-2-thiopseudourea hydrochloride; S-(4-Chlorobenzyl)isothiouronium chloride; S-(p-Chlorobenzyl)-thiouronium chloride; 4-chlorobenzyl carbamimidothioate hydrochloride (1:1); 4-chlorobenzyl carbamimidothioate; amino[(4-chlorobenzyl)sulfanyl]methaniminium |
| Molecular Formula |
C8H10ClN2S |
| Molecular Weight |
201.6959 |
| InChI |
InChI=1/C8H9ClN2S/c9-7-3-1-6(2-4-7)5-12-8(10)11/h1-4H,5H2,(H3,10,11)/p+1 |
| EINECS |
208-871-0 |
| Molecular Structure |
|
| Melting point |
205-208℃ |
| Boiling point |
315.9°C at 760 mmHg |
| Flash point |
144.9°C |
| Vapour Pressur |
0.000423mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
