ChemNet > CAS > 5445-22-7 Methyl 2-bromooctanoate
5445-22-7 Methyl 2-bromooctanoate
| product Name |
Methyl 2-bromooctanoate |
| CAS No |
5445-22-7 |
| Synonyms |
2-Bromooctanoic acid methyl ester; 2-bromo-octanoicacimethylester; Methyl2-bromooctanoate,99+% |
| Molecular Formula |
C9H17BrO2 |
| Molecular Weight |
237.1341 |
| InChI |
InChI=1/C9H17BrO2/c1-3-4-5-6-7-8(10)9(11)12-2/h8H,3-7H2,1-2H3 |
| EINECS |
226-644-4 |
| Molecular Structure |
|
| Density |
1.221g/cm3 |
| Boiling point |
227.7°C at 760 mmHg |
| Refractive index |
1.46 |
| Flash point |
101.9°C |
| Vapour Pressur |
0.0763mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
