ChemNet > CAS > 54509-71-6 1-Iodo-2,3,4,5-tetramethylbenzene
54509-71-6 1-Iodo-2,3,4,5-tetramethylbenzene
| product Name |
1-Iodo-2,3,4,5-tetramethylbenzene |
| CAS No |
54509-71-6 |
| Synonyms |
2,3,4,5-Tetramethyliodobenzene |
| Molecular Formula |
C10H13I |
| Molecular Weight |
260.1147 |
| InChI |
InChI=1/C10H13I/c1-6-5-10(11)9(4)8(3)7(6)2/h5H,1-4H3 |
| Molecular Structure |
|
| Density |
1.472g/cm3 |
| Melting point |
30℃ |
| Boiling point |
278.1°C at 760 mmHg |
| Refractive index |
1.576 |
| Flash point |
124°C |
| Vapour Pressur |
0.00733mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
