ChemNet > CAS > 54610-70-7 thiophene-2-carboximidamide hydrochloride
54610-70-7 thiophene-2-carboximidamide hydrochloride
| product Name |
thiophene-2-carboximidamide hydrochloride |
| CAS No |
54610-70-7 |
| Synonyms |
2-Amidinothiophene Hydrochloride |
| Molecular Formula |
C5H7ClN2S |
| Molecular Weight |
162.6405 |
| InChI |
InChI=1/C5H6N2S.ClH/c6-5(7)4-2-1-3-8-4;/h1-3H,(H3,6,7);1H |
| Molecular Structure |
|
| Melting point |
172℃ |
| Boiling point |
220.8°C at 760 mmHg |
| Flash point |
87.3°C |
| Vapour Pressur |
0.111mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
