ChemNet > CAS > 54629-13-9 2-(4-Fluorophenoxy)nicotinic acid
54629-13-9 2-(4-Fluorophenoxy)nicotinic acid
| product Name |
2-(4-Fluorophenoxy)nicotinic acid |
| CAS No |
54629-13-9 |
| Synonyms |
2-(4-fluorophenoxy)pyridine-3-carboxylic acid; 2-(4-fluorophenoxy)pyridine-3-carboxylate |
| Molecular Formula |
C12H7FNO3 |
| Molecular Weight |
232.1878 |
| InChI |
InChI=1/C12H8FNO3/c13-8-3-5-9(6-4-8)17-11-10(12(15)16)2-1-7-14-11/h1-7H,(H,15,16)/p-1 |
| Molecular Structure |
|
| Melting point |
187-189℃ |
| Boiling point |
365.2°C at 760 mmHg |
| Flash point |
174.7°C |
| Vapour Pressur |
5.63E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
