ChemNet > CAS > 5466-06-8 Ethyl 3-mercaptopropionate
5466-06-8 Ethyl 3-mercaptopropionate
| product Name |
Ethyl 3-mercaptopropionate |
| CAS No |
5466-06-8 |
| Synonyms |
3-Mercaptopropionic Acid Ethyl Ester; ethyl 3-sulfanylpropanoate |
| Molecular Formula |
C5H10O2S |
| Molecular Weight |
134.1967 |
| InChI |
InChI=1/C5H10O2S/c1-2-7-5(6)3-4-8/h8H,2-4H2,1H3 |
| EINECS |
226-771-5 |
| Molecular Structure |
|
| Density |
1.043g/cm3 |
| Boiling point |
194.3°C at 760 mmHg |
| Refractive index |
1.454 |
| Flash point |
72.8°C |
| Vapour Pressur |
0.445mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
