ChemNet > CAS > 5469-19-2 5-Bromo-1,2,4-trimethylbenzene
5469-19-2 5-Bromo-1,2,4-trimethylbenzene
| product Name |
5-Bromo-1,2,4-trimethylbenzene |
| CAS No |
5469-19-2 |
| Synonyms |
5-Bromopseudocumene; 1-bromo-2,4,5-trimethylbenzene |
| Molecular Formula |
C9H11Br |
| Molecular Weight |
199.0876 |
| InChI |
InChI=1/C9H11Br/c1-6-4-8(3)9(10)5-7(6)2/h4-5H,1-3H3 |
| EINECS |
226-793-5 |
| Molecular Structure |
|
| Density |
1.289g/cm3 |
| Melting point |
70-73℃ |
| Boiling point |
234.2°C at 760 mmHg |
| Refractive index |
1.539 |
| Flash point |
96.7°C |
| Vapour Pressur |
0.0818mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
