ChemNet > CAS > 54705-91-8 2-(1H-pyrazol-1-yl)aniline
54705-91-8 2-(1H-pyrazol-1-yl)aniline
| product Name |
2-(1H-pyrazol-1-yl)aniline |
| CAS No |
54705-91-8 |
| Molecular Formula |
C9H9N3 |
| Molecular Weight |
159.1879 |
| InChI |
InChI=1/C9H9N3/c10-8-4-1-2-5-9(8)12-7-3-6-11-12/h1-7H,10H2 |
| Molecular Structure |
|
| Density |
1.2g/cm3 |
| Melting point |
44℃ |
| Boiling point |
305.4°C at 760 mmHg |
| Refractive index |
1.641 |
| Flash point |
138.5°C |
| Vapour Pressur |
0.000822mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
