54745-92-5 2-quinoxaloyl chloride
product Name |
2-quinoxaloyl chloride |
CAS No |
54745-92-5 |
Synonyms |
2-Quinoxalinecarbonyl chloride; quinoxaline-2-carbonyl chloride |
Molecular Formula |
C9H5ClN2O |
Molecular Weight |
192.6018 |
InChI |
InChI=1/C9H5ClN2O/c10-9(13)8-5-11-6-3-1-2-4-7(6)12-8/h1-5H |
EINECS |
259-315-9 |
Molecular Structure |
|
Density |
1.411g/cm3 |
Melting point |
113℃ |
Boiling point |
324.4°C at 760 mmHg |
Refractive index |
1.662 |
Flash point |
150°C |
Vapour Pressur |
0.000246mmHg at 25°C |
Hazard Symbols |
C:Corrosive;
|
Risk Codes |
R34:Causes burns.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
MSDS |
Material Safety Data Sheet
|
|