ChemNet > CAS > 54745-92-5 2-quinoxaloyl chloride
54745-92-5 2-quinoxaloyl chloride
| product Name |
2-quinoxaloyl chloride |
| CAS No |
54745-92-5 |
| Synonyms |
2-Quinoxalinecarbonyl chloride; quinoxaline-2-carbonyl chloride |
| Molecular Formula |
C9H5ClN2O |
| Molecular Weight |
192.6018 |
| InChI |
InChI=1/C9H5ClN2O/c10-9(13)8-5-11-6-3-1-2-4-7(6)12-8/h1-5H |
| EINECS |
259-315-9 |
| Molecular Structure |
|
| Density |
1.411g/cm3 |
| Melting point |
113℃ |
| Boiling point |
324.4°C at 760 mmHg |
| Refractive index |
1.662 |
| Flash point |
150°C |
| Vapour Pressur |
0.000246mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
