ChemNet > CAS > 548-39-0 Perinaphthenone
548-39-0 Perinaphthenone
| product Name |
Perinaphthenone |
| CAS No |
548-39-0 |
| Synonyms |
phenalen-1-one; Perinaphthalenone; 1H-phenalen-1-one |
| Molecular Formula |
C13H8O |
| Molecular Weight |
180.202 |
| InChI |
InChI=1/C13H8O/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10/h1-8H |
| EINECS |
208-945-2 |
| Molecular Structure |
|
| Density |
1.265g/cm3 |
| Melting point |
149-154℃ |
| Boiling point |
355.2°C at 760 mmHg |
| Refractive index |
1.715 |
| Flash point |
157.9°C |
| Vapour Pressur |
3.18E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
