ChemNet > CAS > 54932-72-8 5-Bromo-2-chlorotoluene
54932-72-8 5-Bromo-2-chlorotoluene
| product Name |
5-Bromo-2-chlorotoluene |
| CAS No |
54932-72-8 |
| Synonyms |
4-bromo-1-chloro-2-methylbenzene |
| Molecular Formula |
C7H6BrCl |
| Molecular Weight |
205.4795 |
| InChI |
InChI=1/C7H6BrCl/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| Molecular Structure |
|
| Density |
1.535g/cm3 |
| Boiling point |
216.9°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
99.1°C |
| Vapour Pressur |
0.2mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
