ChemNet > CAS > 5520-66-1 p-Diethylaminoacetophenone
5520-66-1 p-Diethylaminoacetophenone
| product Name |
p-Diethylaminoacetophenone |
| CAS No |
5520-66-1 |
| Synonyms |
4-Diethylaminoacetophenone; 1-[4-(diethylamino)phenyl]ethanone |
| Molecular Formula |
C12H17NO |
| Molecular Weight |
191.2695 |
| InChI |
InChI=1/C12H17NO/c1-4-13(5-2)12-8-6-11(7-9-12)10(3)14/h6-9H,4-5H2,1-3H3 |
| Molecular Structure |
|
| Density |
0.996g/cm3 |
| Boiling point |
313.9°C at 760 mmHg |
| Refractive index |
1.536 |
| Flash point |
114.4°C |
| Vapour Pressur |
0.000482mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
