ChemNet > CAS > 5541-89-9 4-(1H-indol-3-yl)butan-2-one
5541-89-9 4-(1H-indol-3-yl)butan-2-one
| product Name |
4-(1H-indol-3-yl)butan-2-one |
| CAS No |
5541-89-9 |
| Molecular Formula |
C12H13NO |
| Molecular Weight |
187.2377 |
| InChI |
InChI=1/C12H13NO/c1-9(14)6-7-10-8-13-12-5-3-2-4-11(10)12/h2-5,8,13H,6-7H2,1H3 |
| Molecular Structure |
|
| Density |
1.136g/cm3 |
| Melting point |
85℃ |
| Boiling point |
356.1°C at 760 mmHg |
| Refractive index |
1.613 |
| Flash point |
177°C |
| Vapour Pressur |
2.98E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
