ChemNet > CAS > 55440-54-5 5-Chloro-2-methoxyphenyl isocyanate
55440-54-5 5-Chloro-2-methoxyphenyl isocyanate
| product Name |
5-Chloro-2-methoxyphenyl isocyanate |
| CAS No |
55440-54-5 |
| Synonyms |
4-chloro-2-isocyanato-1-methoxybenzene |
| Molecular Formula |
C8H6ClNO2 |
| Molecular Weight |
183.5917 |
| InChI |
InChI=1/C8H6ClNO2/c1-12-8-3-2-6(9)4-7(8)10-5-11/h2-4H,1H3 |
| Molecular Structure |
|
| Density |
1.22g/cm3 |
| Boiling point |
271.7°C at 760 mmHg |
| Refractive index |
1.534 |
| Flash point |
118.1°C |
| Vapour Pressur |
0.00633mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R23/25:Toxic by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
| Safety Description |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
