ChemNet > CAS > 555-30-6 alpha-methyldopa
555-30-6 alpha-methyldopa
| product Name |
alpha-methyldopa |
| CAS No |
555-30-6 |
| Synonyms |
METHYLDOPA; (S)-(-)-alpha-Methyldopa; 3-Hydroxy-alpha-methyl-L-tyrosine; 3-hydroxy-N-methyltyrosine |
| Molecular Formula |
C10H13NO4 |
| Molecular Weight |
211.2145 |
| InChI |
InChI=1/C10H13NO4/c1-11-7(10(14)15)4-6-2-3-8(12)9(13)5-6/h2-3,5,7,11-13H,4H2,1H3,(H,14,15) |
| EINECS |
209-089-2 |
| Molecular Structure |
|
| Density |
1.354g/cm3 |
| Melting point |
300℃ |
| Boiling point |
436.3°C at 760 mmHg |
| Refractive index |
1.608 |
| Flash point |
217.7°C |
| Vapour Pressur |
2.19E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
