ChemNet > CAS > 555-90-8 Nicothiazone
555-90-8 Nicothiazone
| product Name |
Nicothiazone |
| CAS No |
555-90-8 |
| Synonyms |
3-Formylpyridine thiosemicarbazone; Nicotinaldehyde, thiocarbohydrazone; Nicotinaldehyde thiosemicarbazone; Pyridine-3-carboxaldehyde, thiosemicarbazone; ; 2-(pyridin-3-ylmethylidene)hydrazinecarbothioamide; pyridine-3-carbaldehyde thiosemicarbazone; Pyridine-3-aldehyde thiosemicarbazone |
| Molecular Formula |
C7H8N4S |
| Molecular Weight |
180.2302 |
| InChI |
InChI=1/C7H8N4S/c8-7(12)11-10-5-6-2-1-3-9-4-6/h1-5H,(H3,8,11,12)/b10-5+ |
| EINECS |
209-108-4 |
| Molecular Structure |
|
| Density |
1.32g/cm3 |
| Boiling point |
346.5°C at 760 mmHg |
| Refractive index |
1.665 |
| Flash point |
163.3°C |
| Vapour Pressur |
5.74E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R25:Toxic if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
