ChemNet > CAS > 5580-34-7 2,3-Dimethylbenzamide
5580-34-7 2,3-Dimethylbenzamide
| product Name |
2,3-Dimethylbenzamide |
| CAS No |
5580-34-7 |
| Molecular Formula |
C9H11NO |
| Molecular Weight |
149.1897 |
| InChI |
InChI=1/C9H11NO/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5H,1-2H3,(H2,10,11) |
| Molecular Structure |
|
| Density |
1.06g/cm3 |
| Melting point |
154-156℃ |
| Boiling point |
237.7°C at 760 mmHg |
| Refractive index |
1.55 |
| Flash point |
97.6°C |
| Vapour Pressur |
0.0441mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
