ChemNet > CAS > 5585-33-1 2-(4-Morpholino)aniline
5585-33-1 2-(4-Morpholino)aniline
| product Name |
2-(4-Morpholino)aniline |
| CAS No |
5585-33-1 |
| Synonyms |
4-(2-Aminophenyl)morpholine; 2-(morpholin-4-yl)aniline; 2-morpholinoaniline |
| Molecular Formula |
C10H14N2O |
| Molecular Weight |
178.231 |
| InChI |
InChI=1/C10H14N2O/c11-9-3-1-2-4-10(9)12-5-7-13-8-6-12/h1-4H,5-8,11H2 |
| Molecular Structure |
|
| Density |
1.149g/cm3 |
| Melting point |
93℃ |
| Boiling point |
332.5°C at 760 mmHg |
| Refractive index |
1.589 |
| Flash point |
154.9°C |
| Vapour Pressur |
0.000146mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
