ChemNet > CAS > 5600-19-1 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 1-aminopropan-2-ol (1:1)
5600-19-1 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 1-aminopropan-2-ol (1:1)
| product Name |
3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 1-aminopropan-2-ol (1:1) |
| CAS No |
5600-19-1 |
| Synonyms |
Theophylline isopropanolamine; 3,7-Dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 1-aminopropan-2-ol (1:1); 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione; 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 1-aminopropan-2-ol (1:1) |
| Molecular Formula |
C10H17N5O3 |
| Molecular Weight |
255.2737 |
| InChI |
InChI=1/C7H8N4O2.C3H9NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-3(5)2-4/h3H,1-2H3,(H,8,9);3,5H,2,4H2,1H3 |
| EINECS |
227-017-8 |
| Molecular Structure |
|
| Boiling point |
454.1°C at 760 mmHg |
| Flash point |
228.4°C |
| Vapour Pressur |
1.96E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
