ChemNet > CAS > 56041-57-7 2,3-Dichloroacetophenone
56041-57-7 2,3-Dichloroacetophenone
| product Name |
2,3-Dichloroacetophenone |
| CAS No |
56041-57-7 |
| Synonyms |
1-(2,3-Dichlorophenyl)ethan-1-one; 1-(2,3-dichlorophenyl)ethanone |
| Molecular Formula |
C8H6Cl2O |
| Molecular Weight |
189.0386 |
| InChI |
InChI=1/C8H6Cl2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
| EINECS |
259-954-3 |
| Molecular Structure |
|
| Density |
1.304g/cm3 |
| Melting point |
106℃ |
| Boiling point |
247.3°C at 760 mmHg |
| Refractive index |
1.548 |
| Flash point |
101.3°C |
| Vapour Pressur |
0.0258mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
