ChemNet > CAS > 5619-07-8 DL-Phenylalanine methyl ester hydrochloride
5619-07-8 DL-Phenylalanine methyl ester hydrochloride
| product Name |
DL-Phenylalanine methyl ester hydrochloride |
| CAS No |
5619-07-8 |
| Synonyms |
H-DL-Phe-OMe.HCl; methyl L-phenylalaninate hydrochloride (1:1); methyl phenylalaninate hydrochloride; H-DL-Phe-OMe・HCl |
| Molecular Formula |
C10H14ClNO2 |
| Molecular Weight |
215.6767 |
| InChI |
InChI=1/C10H13NO2.ClH/c1-13-10(12)9(11)7-8-5-3-2-4-6-8;/h2-6,9H,7,11H2,1H3;1H |
| EINECS |
227-049-2 |
| Molecular Structure |
|
| Boiling point |
264.2°C at 760 mmHg |
| Flash point |
126°C |
| Vapour Pressur |
0.00986mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
