ChemNet > CAS > 564-94-3 (-)-Myrtenal
564-94-3 (-)-Myrtenal
| product Name |
(-)-Myrtenal |
| CAS No |
564-94-3 |
| Synonyms |
(1R)-()-Myrtenal; pin-2-ene-1-carbaldehyde; 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-carbaldehyde; (1R,5S)-6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-carbaldehyde |
| Molecular Formula |
C10H14O |
| Molecular Weight |
150.2176 |
| InChI |
InChI=1/C10H14O/c1-10(2)8-4-3-7(6-11)9(10)5-8/h3,6,8-9H,4-5H2,1-2H3/t8-,9-/m0/s1 |
| EINECS |
209-274-8 |
| Molecular Structure |
|
| Density |
1.061g/cm3 |
| Boiling point |
215.7°C at 760 mmHg |
| Refractive index |
1.561 |
| Flash point |
78.9°C |
| Vapour Pressur |
0.145mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
