ChemNet > CAS > 56406-50-9 3-Nitrobenzamidine hydrochloride
56406-50-9 3-Nitrobenzamidine hydrochloride
| product Name |
3-Nitrobenzamidine hydrochloride |
| CAS No |
56406-50-9 |
| Synonyms |
3-nitrobenzamidinium hydrochloride; 3-nitrobenzamidinehydrochloride; 3-nitrobenzenecarboximidamide; amino(3-nitrophenyl)methaniminium chloride; amino(3-nitrophenyl)methaniminium |
| Molecular Formula |
C7H8N3O2 |
| Molecular Weight |
166.1568 |
| InChI |
InChI=1/C7H7N3O2/c8-7(9)5-2-1-3-6(4-5)10(11)12/h1-4H,(H3,8,9)/p+1 |
| EINECS |
260-159-9 |
| Molecular Structure |
|
| Melting point |
247-252℃ |
| Boiling point |
301.7°C at 760 mmHg |
| Flash point |
136.3°C |
| Vapour Pressur |
0.00103mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
