ChemNet > CAS > 56430-08-1 2,3-Dimethyl-1-(4-methylphenyl)-3-pyrazolin-5-one
56430-08-1 2,3-Dimethyl-1-(4-methylphenyl)-3-pyrazolin-5-one
| product Name |
2,3-Dimethyl-1-(4-methylphenyl)-3-pyrazolin-5-one |
| CAS No |
56430-08-1 |
| Synonyms |
4-Methylphenazone; 1,5-dimethyl-2-(4-methylphenyl)-1,2-dihydro-3H-pyrazol-3-one |
| Molecular Formula |
C12H14N2O |
| Molecular Weight |
202.2524 |
| InChI |
InChI=1/C12H14N2O/c1-9-4-6-11(7-5-9)14-12(15)8-10(2)13(14)3/h4-8H,1-3H3 |
| EINECS |
260-175-6 |
| Molecular Structure |
|
| Density |
1.129g/cm3 |
| Melting point |
134-137℃ |
| Boiling point |
313.8°C at 760 mmHg |
| Refractive index |
1.577 |
| Flash point |
131.8°C |
| Vapour Pressur |
0.000485mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
