ChemNet > CAS > 565-68-4 4-methylpentyn-3-ol
565-68-4 4-methylpentyn-3-ol
| product Name |
4-methylpentyn-3-ol |
| CAS No |
565-68-4 |
| Synonyms |
1-Isopropylpropargyl alcohol; 1-pentyn-3-ol, 4-methyl-; 4-Methyl-1-pentyne-3-ol; 4-Methylpent-1-yn-3-ol |
| Molecular Formula |
C6H10O |
| Molecular Weight |
98.143 |
| InChI |
InChI=1/C6H10O/c1-4-6(7)5(2)3/h1,5-7H,2-3H3 |
| EINECS |
209-287-9 |
| Molecular Structure |
|
| Density |
0.895g/cm3 |
| Boiling point |
139.3°C at 760 mmHg |
| Refractive index |
1.444 |
| Flash point |
41.9°C |
| Vapour Pressur |
2.69mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
