ChemNet > CAS > 5678-48-8 3-Amino-3-(2-nitrophenyl)propionic acid
5678-48-8 3-Amino-3-(2-nitrophenyl)propionic acid
| product Name |
3-Amino-3-(2-nitrophenyl)propionic acid |
| CAS No |
5678-48-8 |
| Synonyms |
3-Amino-3-(2-nitrophenyl)propanoic acid; (3R)-3-amino-3-(2-nitrophenyl)propanoic acid; (3S)-3-ammonio-3-(2-nitrophenyl)propanoate |
| Molecular Formula |
C9H10N2O4 |
| Molecular Weight |
210.1867 |
| InChI |
InChI=1/C9H10N2O4/c10-7(5-9(12)13)6-3-1-2-4-8(6)11(14)15/h1-4,7H,5,10H2,(H,12,13)/t7-/m0/s1 |
| Molecular Structure |
|
| Density |
1.404g/cm3 |
| Melting point |
218℃ |
| Boiling point |
423.8°C at 760 mmHg |
| Refractive index |
1.612 |
| Flash point |
210.1°C |
| Vapour Pressur |
6.13E-08mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
