CAS No: 568-63-8, Chemical Name: Erythrosine B
Chemical CAS Database with Global Chemical Suppliers - ChemNet
the physical and chemical property of 568-63-8, Erythrosine B is provided by ChemNet.com


   ChemNet > CAS > 568-63-8 Erythrosine B

568-63-8 Erythrosine B

product Name Erythrosine B
Synonyms Erythrosin B
Molecular Formula C20H6I4Na2O5
Molecular Weight 879.86
InChI InChI=1/C20H8I4O5.2Na/c21-11-5-9-13(7-3-1-2-4-8(7)20(27)28)10-6-12(22)17(26)15(24)19(10)29-18(9)14(23)16(11)25;;/h1-6,25H,(H,27,28);;/q;2*+1/p-2
CAS Registry Number 568-63-8
EINECS 240-474-8
Molecular Structure 568-63-8 Erythrosine B
Hazard Symbols  Xn:Harmful;
Risk Codes R22:;
Safety Description S36:;