ChemNet > CAS > 56843-28-8 2,4-dichlorobenzaldehyde oxime
56843-28-8 2,4-dichlorobenzaldehyde oxime
| product Name |
2,4-dichlorobenzaldehyde oxime |
| CAS No |
56843-28-8 |
| Synonyms |
Benzaldehyde, 2,4-dichloro-, oxime; 0-07-00-00237 (Beilstein Handbook Reference); 2,4-Dichlorobenzaldehyde oxime; 2,4-Dichlorobenzaldoxime; BRN 2574814; Benzaldoxime, 2,4-dichlor0-; 1-(2,4-dichlorophenyl)-N-hydroxymethanimine |
| Molecular Formula |
C7H5Cl2NO |
| Molecular Weight |
190.0267 |
| InChI |
InChI=1/C7H5Cl2NO/c8-6-2-1-5(4-10-11)7(9)3-6/h1-4,11H/b10-4+ |
| Molecular Structure |
|
| Density |
1.38g/cm3 |
| Melting point |
134℃ |
| Boiling point |
271.3°C at 760 mmHg |
| Refractive index |
1.575 |
| Flash point |
117.9°C |
| Vapour Pressur |
0.00319mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
