ChemNet > CAS > 56962-08-4 4,5-Dichlorophthalic acid
56962-08-4 4,5-Dichlorophthalic acid
| product Name |
4,5-Dichlorophthalic acid |
| CAS No |
56962-08-4 |
| Synonyms |
1,2-Benzenedicarboxylic acid, 4,5-dichloro-; 4,5-dichlorobenzene-1,2-dicarboxylic acid |
| Molecular Formula |
C8H4Cl2O4 |
| Molecular Weight |
235.021 |
| InChI |
InChI=1/C8H4Cl2O4/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2H,(H,11,12)(H,13,14) |
| EINECS |
260-478-3 |
| Molecular Structure |
|
| Density |
1.698g/cm3 |
| Melting point |
193-195℃ |
| Boiling point |
422.1°C at 760 mmHg |
| Refractive index |
1.64 |
| Flash point |
209.1°C |
| Vapour Pressur |
7.05E-08mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
