ChemNet > CAS > 570-08-1 Diethyl acetylmalonate
570-08-1 Diethyl acetylmalonate
| product Name |
Diethyl acetylmalonate |
| CAS No |
570-08-1 |
| Synonyms |
Acetylmalonic acid diethyl ester; (2-ethylbutanoyl)propanedioate |
| Molecular Formula |
C9H12O5 |
| Molecular Weight |
200.1897 |
| InChI |
InChI=1/C9H14O5/c1-3-5(4-2)7(10)6(8(11)12)9(13)14/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14)/p-2 |
| Molecular Structure |
|
| Boiling point |
372.3°C at 760 mmHg |
| Flash point |
193.1°C |
| Vapour Pressur |
1.45E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
