ChemNet > CAS > 57012-20-1 (1,3-dimethyl-1H-pyrazol-5-yl)methanol
57012-20-1 (1,3-dimethyl-1H-pyrazol-5-yl)methanol
| product Name |
(1,3-dimethyl-1H-pyrazol-5-yl)methanol |
| CAS No |
57012-20-1 |
| Molecular Formula |
C6H10N2O |
| Molecular Weight |
126.1564 |
| InChI |
InChI=1/C6H10N2O/c1-5-3-6(4-9)8(2)7-5/h3,9H,4H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.13g/cm3 |
| Boiling point |
248.6°C at 760 mmHg |
| Refractive index |
1.543 |
| Flash point |
104.1°C |
| Vapour Pressur |
0.0127mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
