ChemNet > CAS > 571-61-9 1,5-Dimethylnaphthalene
571-61-9 1,5-Dimethylnaphthalene
| product Name |
1,5-Dimethylnaphthalene |
| CAS No |
571-61-9 |
| Synonyms |
NSC 59388; Naphthalene, 1,5-dimethyl-; Naphthalene, 1,5-dimethyl- (8CI)(9CI); N-methyl-N-nitrosomethanamine |
| Molecular Formula |
C12H12 |
| Molecular Weight |
156.2237 |
| InChI |
InChI=1/C12H12/c1-9-5-3-8-12-10(2)6-4-7-11(9)12/h3-8H,1-2H3 |
| EINECS |
209-338-5 |
| Molecular Structure |
|
| Density |
1g/cm3 |
| Melting point |
78-266℃ |
| Boiling point |
265.6°C at 760 mmHg |
| Refractive index |
1.604 |
| Flash point |
111.4°C |
| Vapour Pressur |
0.0149mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
