ChemNet > CAS > 5714-73-8 N-benzoylglycine, compound with 1,3,5,7-tetraazatricyclo[3.3.1.13,7]decane (1:1)
5714-73-8 N-benzoylglycine, compound with 1,3,5,7-tetraazatricyclo[3.3.1.13,7]decane (1:1)
| product Name |
N-benzoylglycine, compound with 1,3,5,7-tetraazatricyclo[3.3.1.13,7]decane (1:1) |
| CAS No |
5714-73-8 |
| Synonyms |
Methenamine Hippurate; N-benzoylglycine - 1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane (1:1) |
| Molecular Formula |
C15H21N5O3 |
| Molecular Weight |
319.3589 |
| InChI |
InChI=1/C9H9NO3.C6H12N4/c11-8(12)6-10-9(13)7-4-2-1-3-5-7;1-7-2-9-4-8(1)5-10(3-7)6-9/h1-5H,6H2,(H,10,13)(H,11,12);1-6H2 |
| EINECS |
227-206-5 |
| Molecular Structure |
![5714-73-8 N-benzoylglycine, compound with 1,3,5,7-tetraazatricyclo[3.3.1.13,7]decane (1:1)](https://images-a.chemnet.com/suppliers/chembase/cas4/cas5714-73-8.gif)
|
| Boiling point |
464.1°C at 760 mmHg |
| Flash point |
234.5°C |
| Vapour Pressur |
2.06E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
