ChemNet > CAS > 57238-76-3 5-(Chloromethyl)-3-(4-methoxyphenyl)- 1,2,4-oxadiazole
57238-76-3 5-(Chloromethyl)-3-(4-methoxyphenyl)- 1,2,4-oxadiazole
| product Name |
5-(Chloromethyl)-3-(4-methoxyphenyl)- 1,2,4-oxadiazole |
| CAS No |
57238-76-3 |
| Synonyms |
5-(chloromethyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
| Molecular Formula |
C10H9ClN2O2 |
| Molecular Weight |
224.6437 |
| InChI |
InChI=1/C10H9ClN2O2/c1-14-8-4-2-7(3-5-8)10-12-9(6-11)15-13-10/h2-5H,6H2,1H3 |
| Molecular Structure |
|
| Density |
1.278g/cm3 |
| Melting point |
51℃ |
| Boiling point |
354.9°C at 760 mmHg |
| Refractive index |
1.547 |
| Flash point |
168.4°C |
| Vapour Pressur |
6.63E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
