ChemNet > CAS > 5724-56-1 2,3-Dimethylbenzonitrile
5724-56-1 2,3-Dimethylbenzonitrile
| product Name |
2,3-Dimethylbenzonitrile |
| CAS No |
5724-56-1 |
| Synonyms |
Benzonitrile, 2,3-dimethyl-; 2,3-Dimethylbenzonitril; 2,3-Dimethylbenzonitril [German]; 4-09-00-01798 (Beilstein Handbook Reference); BRN 1932620 |
| Molecular Formula |
C9H9N |
| Molecular Weight |
131.1745 |
| InChI |
InChI=1/C9H9N/c1-7-4-3-5-9(6-10)8(7)2/h3-5H,1-2H3 |
| EINECS |
227-229-0 |
| Molecular Structure |
|
| Density |
0.99g/cm3 |
| Boiling point |
241.7°C at 760 mmHg |
| Refractive index |
1.525 |
| Flash point |
100°C |
| Vapour Pressur |
0.0353mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
